CAS 1226909-66-5 appears in our catalog under these names: DLin–MC4–DMA, DLIN-MC4-DMA/ 99.27% (existing batch purity), DLin-M-C4-DMA 98%, (6Z,9Z,28Z,31Z)-Heptatriaconta-6,9,28,31-tetraen-19-yl 5-(dimethylamino)pentanoate, 98%, 98%, DLin-M-C4-DMA, 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 5 mg.
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-(dimethylamino)pentanoate (CAS 1226909-66-5) is a chemical compound with the molecular formula C44H81NO2 and a molecular weight of 656.1 g/mol. IUPAC name: [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-(dimethylamino)pentanoate. InChIKey: QNUBVWOFCJNYJO-KWXKLSQISA-N.
| Molecular formula | C44H81NO2 |
|---|---|
| Molecular weight | 656.1 g/mol |
| IUPAC name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] 5-(dimethylamino)pentanoate |
| InChIKey | QNUBVWOFCJNYJO-KWXKLSQISA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(OC(=O)CCCCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
Computed by PubChem (NCBI)