cas: 10466-75-8 — see every product listed under this CAS number, including other names
DNP-gamma-Amino-n-Butyric Acid, 95%+, 95%+ (CAS 10466-75-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AGC-100mg |
| cas | 10466-75-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 500mg | 1144.40 Pln | |
| Chemat | 1g | 1859.60 Pln | |
| Chemat | 5g | 4835.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-(2,4-dinitroanilino)butanoic acid (CAS 10466-75-8) is a chemical compound with the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. IUPAC name: 4-(2,4-dinitroanilino)butanoic acid. InChIKey: VZQBXLQRVMDXRH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O6 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | 4-(2,4-dinitroanilino)butanoic acid |
| InChIKey | VZQBXLQRVMDXRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCCC(=O)O |
Computed by PubChem (NCBI)