CAS 10466-75-8 appears in our catalog under these names: Dnp-gamma-amino-n-butyric acid, 95%, DNP–gamma–Amino–n–Butyric Acid, 4-((2,4-Dinitrophenyl)amino)butanoic acid, DNP-gamma-Amino-n-Butyric Acid, 95%+, 95%+, 4-((2,4-dinitrophenyl)amino)butanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg, 0,5g, 50mg.
4-(2,4-dinitroanilino)butanoic acid (CAS 10466-75-8) is a chemical compound with the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. IUPAC name: 4-(2,4-dinitroanilino)butanoic acid. InChIKey: VZQBXLQRVMDXRH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O6 |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | 4-(2,4-dinitroanilino)butanoic acid |
| InChIKey | VZQBXLQRVMDXRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCCC(=O)O |
Computed by PubChem (NCBI)