CAS 958233-07-3 appears in our catalog under these names: DPA-714/ 99.85% (existing batch purity), DPA–714, DPA-714, DPA-714 99%, DPA-714, 99.86%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
N,N-diethyl-2-[2-[4-(2-fluoroethoxy)phenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl]acetamide (CAS 958233-07-3) is a chemical compound with the molecular formula C22H27FN4O2 and a molecular weight of 398.5 g/mol. IUPAC name: N,N-diethyl-2-[2-[4-(2-fluoroethoxy)phenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl]acetamide. InChIKey: FLZZFWBNYJNHMY-UHFFFAOYSA-N.
| Molecular formula | C22H27FN4O2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | N,N-diethyl-2-[2-[4-(2-fluoroethoxy)phenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl]acetamide |
| InChIKey | FLZZFWBNYJNHMY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CC1=C2N=C(C=C(N2N=C1C3=CC=C(C=C3)OCCF)C)C |
Computed by PubChem (NCBI)