CAS 2101765-81-3 appears in our catalog under these names: DRI-C21045/ 98.1% (existing batch purity), DRI–C21045, DRI-c21045, DRI-C20145, DRI-C21045, 98.11%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
8-[[4-[4-[(4-methoxycarbonylbenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid (CAS 2101765-81-3) is a chemical compound with the molecular formula C32H24N2O7S and a molecular weight of 580.6 g/mol. IUPAC name: 8-[[4-[4-[(4-methoxycarbonylbenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid. InChIKey: BZAWLSZPOBGURT-UHFFFAOYSA-N.
| Molecular formula | C32H24N2O7S |
|---|---|
| Molecular weight | 580.6 g/mol |
| IUPAC name | 8-[[4-[4-[(4-methoxycarbonylbenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid |
| InChIKey | BZAWLSZPOBGURT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)NC4=CC=CC5=C4C(=CC=C5)S(=O)(=O)O |
Computed by PubChem (NCBI)