CAS 1222104-37-1 appears in our catalog under these names: DS–7423, DS-7423/ 99.68% (existing batch purity), DS-7423 99%, DS-7423, 99%, 99%, DS-7423, 99.83%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 50 mg, 100 mg.
1-[(2R)-4-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-8-yl]-2-methylpiperazin-1-yl]ethanone (CAS 1222104-37-1) is a chemical compound with the molecular formula C22H27F3N10O2 and a molecular weight of 520.5 g/mol. IUPAC name: 1-[(2R)-4-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-8-yl]-2-methylpiperazin-1-yl]ethanone. InChIKey: SOJJMSYMCLIQCZ-CYBMUJFWSA-N.
| Molecular formula | C22H27F3N10O2 |
|---|---|
| Molecular weight | 520.5 g/mol |
| IUPAC name | 1-[(2R)-4-[2-(2-aminopyrimidin-5-yl)-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-8-yl]-2-methylpiperazin-1-yl]ethanone |
| InChIKey | SOJJMSYMCLIQCZ-CYBMUJFWSA-N |
| SMILES | C[C@@H]1CN(CCN1C(=O)C)C2=NC3=C(N2CC(F)(F)F)N=C(N=C3N4CCOCC4)C5=CN=C(N=C5)N |
Computed by PubChem (NCBI)