CAS 1282041-94-4 appears in our catalog under these names: DSM265/ 99.79% (existing batch purity), DSM265, DSM265 98%, DSM 265, 99%, 99%, DSM265, 99.92%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 50mg, 250mg.
2-(1,1-difluoroethyl)-5-methyl-N-[4-(pentafluoro-lambda6-sulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS 1282041-94-4) is a chemical compound with the molecular formula C14H12F7N5S and a molecular weight of 415.33 g/mol. IUPAC name: 2-(1,1-difluoroethyl)-5-methyl-N-[4-(pentafluoro-lambda6-sulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine. InChIKey: OIZSVTOIBNSVOS-UHFFFAOYSA-N.
| Molecular formula | C14H12F7N5S |
|---|---|
| Molecular weight | 415.33 g/mol |
| IUPAC name | 2-(1,1-difluoroethyl)-5-methyl-N-[4-(pentafluoro-lambda6-sulfanyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | OIZSVTOIBNSVOS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)NC3=CC=C(C=C3)S(F)(F)(F)(F)F)C(C)(F)F |
Computed by PubChem (NCBI)