CAS 2011769-21-2 appears in our catalog under these names: DSM421/ 99.93% (existing batch purity), DSM421, DSM-421. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
2-(1,1-difluoroethyl)-5-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS 2011769-21-2) is a chemical compound with the molecular formula C14H11F5N6 and a molecular weight of 358.27 g/mol. IUPAC name: 2-(1,1-difluoroethyl)-5-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine. InChIKey: HDLFZCDEGAWEFX-UHFFFAOYSA-N.
| Molecular formula | C14H11F5N6 |
|---|---|
| Molecular weight | 358.27 g/mol |
| IUPAC name | 2-(1,1-difluoroethyl)-5-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | HDLFZCDEGAWEFX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)NC3=CN=C(C=C3)C(F)(F)F)C(C)(F)F |
Computed by PubChem (NCBI)