CAS 924296-18-4 appears in our catalog under these names: DUB-IN-1/ 97.11% (existing batch purity), 9-((Benzyloxy)imino)-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 99%, 99%, DUB-IN-1, 99.79%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(9E)-9-phenylmethoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CAS 924296-18-4) is a chemical compound with the molecular formula C20H11N5O and a molecular weight of 337.3 g/mol. IUPAC name: (9E)-9-phenylmethoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile. InChIKey: GKOWDIBLCDZJHF-NCELDCMTSA-N.
| Molecular formula | C20H11N5O |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | (9E)-9-phenylmethoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| InChIKey | GKOWDIBLCDZJHF-NCELDCMTSA-N |
| SMILES | C1=CC=C(C=C1)CO/N=C/2\C3=CC=CC=C3C4=NC(=C(N=C42)C#N)C#N |
Computed by PubChem (NCBI)