CAS 924296-17-3 appears in our catalog under these names: DUBs–IN–3, DUB-IN-3, 99.00%, DUB-IN-3/ 99.34% (existing batch purity), 9-((Allyloxy)imino)-9H-indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 99%, 99%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 100mg, 2mg, 5mg, 10mM (in 1ml dmso), 50mg, 100 mg, 50 mg.
(9E)-9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CAS 924296-17-3) is a chemical compound with the molecular formula C16H9N5O and a molecular weight of 287.28 g/mol. IUPAC name: (9E)-9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile. InChIKey: XLOXSIKLUAMDGU-RCCKNPSSSA-N.
| Molecular formula | C16H9N5O |
|---|---|
| Molecular weight | 287.28 g/mol |
| IUPAC name | (9E)-9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| InChIKey | XLOXSIKLUAMDGU-RCCKNPSSSA-N |
| SMILES | C=CCO/N=C/1\C2=CC=CC=C2C3=NC(=C(N=C31)C#N)C#N |
Computed by PubChem (NCBI)