CAS 139340-56-0 appears in our catalog under these names: Darbufelone mesylate/ 96.81% (existing batch purity), Darbufelone mesylate (CI–1004 mesylate), Darbufelone mesylate, Darbufelone (mesylate), Darbufelone (mesylate), 99.65%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 1mg, 10mg, 50mg, 100mg, 200mg, 50 mg.
(5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;methanesulfonic acid (CAS 139340-56-0) is a chemical compound with the molecular formula C19H28N2O5S2 and a molecular weight of 428.6 g/mol. IUPAC name: (5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;methanesulfonic acid. InChIKey: BAZGFSKJAVQJJI-CHHCPSLASA-N.
| Molecular formula | C19H28N2O5S2 |
|---|---|
| Molecular weight | 428.6 g/mol |
| IUPAC name | (5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one;methanesulfonic acid |
| InChIKey | BAZGFSKJAVQJJI-CHHCPSLASA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C\2/C(=O)N=C(S2)N.CS(=O)(=O)O |
Computed by PubChem (NCBI)