Darodipine
cas: 72803-02-2 — see every product listed under this CAS number, including other names
Darodipine (CAS 72803-02-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 2 mg. Offered by: TargetMol, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T15053-1mg |
| cas | 72803-02-2 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 545.46 Pln | |
| TargetMol | 2mg | 691.36 Pln | |
| TargetMol | 5mg | 903.78 Pln | |
| TargetMol | 10mg | 1189.43 Pln | |
| TargetMol | 25mg | 2012.84 Pln | |
| TargetMol | 50mg | 3334.31 Pln | |
| Chemat | 1mg | 246.80 Pln | |
| Chemat | 5mg | 448.40 Pln | |
| Chemat | 10mg | 616.40 Pln | |
| Chemat | 25mg | 1067.60 Pln | |
| Chemat | 50mg | 1566.80 Pln | |
| MedChemExpress | 2 mg | 900.19 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
Diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 72803-02-2) is a chemical compound with the molecular formula C19H21N3O5 and a molecular weight of 371.4 g/mol. IUPAC name: diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: QERUYFVNIOLCHV-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | diethyl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | QERUYFVNIOLCHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC3=NON=C32)C(=O)OCC)C)C |
Computed by PubChem (NCBI)