CAS 17263-44-4 appears in our catalog under these names: Z-Gly-tyr-nh2, 98%, Z–Gly–Tyr–NH₂. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25g, 5g.
Benzyl N-[2-[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate (CAS 17263-44-4) is a chemical compound with the molecular formula C19H21N3O5 and a molecular weight of 371.4 g/mol. IUPAC name: benzyl N-[2-[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate. InChIKey: YYZXAAJFIOIYGD-INIZCTEOSA-N.
| Molecular formula | C19H21N3O5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | benzyl N-[2-[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate |
| InChIKey | YYZXAAJFIOIYGD-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N |
Computed by PubChem (NCBI)