cas: 1420-40-2 — see every product listed under this CAS number, including other names
Decamethonium Iodide (CAS 1420-40-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10mg, 5g, 25mg, 50mg, 100mg, 25g. Offered by: Mikromol, LoGiCal, GLPBio, TargetMol.
| brand | Mikromol |
|---|---|
| catalog number | MM3044.00 |
| cas | 1420-40-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Mikromol | 250mg | price on request | |
| LoGiCal | 10mg | price on request | |
| GLPBio | 5g | 653.21 Pln | |
| TargetMol | 25mg | 9789.65 Pln | |
| TargetMol | 50mg | 12691.41 Pln | |
| TargetMol | 100mg | 15972.19 Pln | |
| TCI | 5g | 400.12 Pln | |
| TCI | 25g | 1245.88 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide (CAS 1420-40-2) is a chemical compound with the molecular formula C16H38I2N2 and a molecular weight of 512.30 g/mol. IUPAC name: trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide. InChIKey: ARMLJSXXXFXSLQ-UHFFFAOYSA-L.
| Molecular formula | C16H38I2N2 |
|---|---|
| Molecular weight | 512.30 g/mol |
| IUPAC name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide |
| InChIKey | ARMLJSXXXFXSLQ-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)