CAS 1322062-57-6 appears in our catalog under these names: Decarboxy Moxifloxacin, Moxifloxacin Impurity 38;Moxifloxacin Impurity X, Decarboxy Moxifloxacin, >95% (HPLC), Decarboxy Moxifloxacin/ 99.43% (existing batch purity), Decarboxy Moxifloxacin. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 100mg, 10mg, 1mg, 5mg, 25mg, 50mg, 200mg.
7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxyquinolin-4-one (CAS 1322062-57-6) is a chemical compound with the molecular formula C20H24FN3O2 and a molecular weight of 357.4 g/mol. IUPAC name: 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxyquinolin-4-one. InChIKey: OULQTEYVKYNDBD-BLLLJJGKSA-N.
| Molecular formula | C20H24FN3O2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxyquinolin-4-one |
| InChIKey | OULQTEYVKYNDBD-BLLLJJGKSA-N |
| SMILES | COC1=C2C(=CC(=C1N3C[C@@H]4CCCN[C@@H]4C3)F)C(=O)C=CN2C5CC5 |
Computed by PubChem (NCBI)