Products 2033173-31-6

CAS 2033173-31-6 is the registry number for Moxifloxacin Impurity 87. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-carboxylate (CAS 2033173-31-6) is a chemical compound with the molecular formula C20H24FN3O2 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl 4-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-carboxylate. InChIKey: ZKMYXGYPKBFKFD-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24FN3O2
Molecular weight357.4 g/mol
IUPAC nametert-butyl 4-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)piperidine-1-carboxylate
InChIKeyZKMYXGYPKBFKFD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)C2C3=C(C=CC=C3F)C4=CN=CN24

Computed by PubChem (NCBI)