cas: 32339-43-8 — see every product listed under this CAS number, including other names
Decyltriphenylphosphonium bromide, 95+% (CAS 32339-43-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A741600-5g |
| cas | 32339-43-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 200.20 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Decyl(triphenyl)phosphanium bromide (CAS 32339-43-8) is a chemical compound with the molecular formula C28H36BrP and a molecular weight of 483.5 g/mol. IUPAC name: decyl(triphenyl)phosphanium bromide. InChIKey: GVPLMQGXUUHCSB-UHFFFAOYSA-M.
| Molecular formula | C28H36BrP |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | decyl(triphenyl)phosphanium bromide |
| InChIKey | GVPLMQGXUUHCSB-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)