CAS 32339-43-8 appears in our catalog under these names: (Dec-1-yl)(triphenyl)phosphonium bromide, 95%, Decyltriphenylphosphonium bromide, 95+%, Decyl-TPP bromide, Decyltriphenylphosphonium bromide, Decyl-TPP bromide, min. 95 %, 500 g. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Roth. Available pack sizes: 100g, 500g, 5g, 25g, 1g, 100 mg, 500 mg, 50 mg.
Decyl(triphenyl)phosphanium bromide (CAS 32339-43-8) is a chemical compound with the molecular formula C28H36BrP and a molecular weight of 483.5 g/mol. IUPAC name: decyl(triphenyl)phosphanium bromide. InChIKey: GVPLMQGXUUHCSB-UHFFFAOYSA-M.
| Molecular formula | C28H36BrP |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | decyl(triphenyl)phosphanium bromide |
| InChIKey | GVPLMQGXUUHCSB-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)