cas: 856243-80-6 — see every product listed under this CAS number, including other names
Degrasyn 98+% (CAS 856243-80-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535148-1mg |
| cas | 856243-80-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 253.56 Pln | |
| Ambeed | 5mg | 337.00 Pln | |
| Ambeed | 10mg | 531.69 Pln | |
| Ambeed | 25mg | 1071.25 Pln | |
| Ambeed | 50mg | 1666.44 Pln | |
| Ambeed | 100mg | 2612.06 Pln | |
| Ambeed | 250mg | 4970.56 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A535148 |
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide (CAS 856243-80-6) is a chemical compound with the molecular formula C19H18BrN3O and a molecular weight of 384.3 g/mol. IUPAC name: (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide. InChIKey: LIDOPKHSVQTSJY-VMEIHUARSA-N.
| Molecular formula | C19H18BrN3O |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide |
| InChIKey | LIDOPKHSVQTSJY-VMEIHUARSA-N |
| SMILES | CCC[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=NC(=CC=C2)Br)/C#N |
Computed by PubChem (NCBI)