CAS 856243-80-6 appears in our catalog under these names: WP1130, Degrasyn/ 99.98% (existing batch purity), WP 1130, Degrasyn 98+%, WP1130 1PC X 10MG. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 2mg, 1mg.
(E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide (CAS 856243-80-6) is a chemical compound with the molecular formula C19H18BrN3O and a molecular weight of 384.3 g/mol. IUPAC name: (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide. InChIKey: LIDOPKHSVQTSJY-VMEIHUARSA-N.
| Molecular formula | C19H18BrN3O |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | (E)-3-(6-bromo-2-pyridinyl)-2-cyano-N-[(1S)-1-phenylbutyl]prop-2-enamide |
| InChIKey | LIDOPKHSVQTSJY-VMEIHUARSA-N |
| SMILES | CCC[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=NC(=CC=C2)Br)/C#N |
Computed by PubChem (NCBI)