Delgocitinib, 99%, 99%
cas: 1263774-59-9 — see every product listed under this CAS number, including other names
Delgocitinib, 99%, 99% (CAS 1263774-59-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EO72-1mg |
| cas | 1263774-59-9 |
| size | 1mg |
| availability | 1.25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 342.80 Pln | |
| Chemat | 2mg | 530.00 Pln | |
| Chemat | 5mg | 904.40 Pln | |
| Chemat | 10mg | 1499.60 Pln | |
| Chemat | 25mg | 2934.80 Pln | |
| Chemat | 50mg | 4370.00 Pln | |
| Chemat | 100mg | 6520.40 Pln | |
| Chemat | 250mg | 11042.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-[(3S,4R)-3-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-oxopropanenitrile (CAS 1263774-59-9) is a chemical compound with the molecular formula C16H18N6O and a molecular weight of 310.35 g/mol. IUPAC name: 3-[(3S,4R)-3-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-oxopropanenitrile. InChIKey: LOWWYYZBZNSPDT-ZBEGNZNMSA-N.
| Molecular formula | C16H18N6O |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | 3-[(3S,4R)-3-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,7-diazaspiro[3.4]octan-1-yl]-3-oxopropanenitrile |
| InChIKey | LOWWYYZBZNSPDT-ZBEGNZNMSA-N |
| SMILES | C[C@H]1CN([C@]12CCN(C2)C3=NC=NC4=C3C=CN4)C(=O)CC#N |
Computed by PubChem (NCBI)