CAS 2454017-83-3 is the registry number for NLRP3 antagonist 1, 98.86%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 100 mg, 50 mg, 25 mg, 10mM/1mL.
Cis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol (CAS 2454017-83-3) is a chemical compound with the molecular formula C16H18N6O and a molecular weight of 310.35 g/mol. IUPAC name: cis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol. InChIKey: VVVAZTNDJMQDEL-OCCSQVGLSA-N.
| Molecular formula | C16H18N6O |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | cis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol |
| InChIKey | VVVAZTNDJMQDEL-OCCSQVGLSA-N |
| SMILES | C1C[C@H]([C@H](C1)O)NC2=NC(=NC3=C2C=CC(=C3)C4=CC=NN4)N |
Computed by PubChem (NCBI)