Products 2454017-83-3

CAS 2454017-83-3 is the registry number for NLRP3 antagonist 1, 98.86%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 100 mg, 50 mg, 25 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

Cis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol (CAS 2454017-83-3) is a chemical compound with the molecular formula C16H18N6O and a molecular weight of 310.35 g/mol. IUPAC name: cis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol. InChIKey: VVVAZTNDJMQDEL-OCCSQVGLSA-N.

Identity
Molecular formulaC16H18N6O
Molecular weight310.35 g/mol
IUPAC namecis-(1S,2R)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinazolin-4-yl]amino]cyclopentan-1-ol
InChIKeyVVVAZTNDJMQDEL-OCCSQVGLSA-N
SMILESC1C[C@H]([C@H](C1)O)NC2=NC(=NC3=C2C=CC(=C3)C4=CC=NN4)N

Computed by PubChem (NCBI)