CAS 1219707-39-7 appears in our catalog under these names: Delpazolid/ 99.87% (existing batch purity), Delpazolid, Delpazolid 98+%, Lcb01-0371, 98+%, 98+%, Delpazolid, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(5R)-3-[3-fluoro-4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 1219707-39-7) is a chemical compound with the molecular formula C14H17FN4O3 and a molecular weight of 308.31 g/mol. IUPAC name: (5R)-3-[3-fluoro-4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: QLUWQAFDTNAYPN-LLVKDONJSA-N.
| Molecular formula | C14H17FN4O3 |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | (5R)-3-[3-fluoro-4-(1-methyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | QLUWQAFDTNAYPN-LLVKDONJSA-N |
| SMILES | CN1CCN(C=N1)C2=C(C=C(C=C2)N3C[C@@H](OC3=O)CO)F |
Computed by PubChem (NCBI)