cas: 123853-39-4 — see every product listed under this CAS number, including other names
Desethyl Felodipine 95% (CAS 123853-39-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157376-500g |
| cas | 123853-39-4 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 21168.56 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 509.44 Pln | |
| Ambeed | 25g | 1666.44 Pln | |
| Ambeed | 100g | 5343.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A157376 |
4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CAS 123853-39-4) is a chemical compound with the molecular formula C16H15Cl2NO4 and a molecular weight of 356.2 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid. InChIKey: LHAOQTPGTBGTIG-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO4 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| InChIKey | LHAOQTPGTBGTIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)