CAS 105580-45-8 appears in our catalog under these names: Clevidipine Impurity 4, Felodipine Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CAS 105580-45-8) is a chemical compound with the molecular formula C16H15Cl2NO4 and a molecular weight of 356.2 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid. InChIKey: LHAOQTPGTBGTIG-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO4 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| InChIKey | LHAOQTPGTBGTIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)