Products 105580-45-8

CAS 105580-45-8 appears in our catalog under these names: Clevidipine Impurity 4, Felodipine Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CAS 105580-45-8) is a chemical compound with the molecular formula C16H15Cl2NO4 and a molecular weight of 356.2 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid. InChIKey: LHAOQTPGTBGTIG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15Cl2NO4
Molecular weight356.2 g/mol
IUPAC name4-(2,3-dichlorophenyl)-5-methoxycarbonyl-2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid
InChIKeyLHAOQTPGTBGTIG-UHFFFAOYSA-N
SMILESCC1=C(C(C(=C(N1)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)