Di(naphthalen-2-yl)phosphine oxide, 97%
cas: 78871-05-3 — see every product listed under this CAS number, including other names
Di(naphthalen-2-yl)phosphine oxide, 97% (CAS 78871-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F499161-1G |
| cas | 78871-05-3 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 789.32 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 559.50 Pln | |
| Ambeed | 25g | 2256.06 Pln | |
| Ambeed | 100g | 7067.62 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 467.60 Pln | |
| Chemat | 25g | 1072.40 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 597.59 Pln | |
| BLDpharm | 25g | 2424.73 Pln | |
| BLDpharm | 100g | 7611.79 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Dinaphthalen-2-yl(oxo)phosphanium (CAS 78871-05-3) is a chemical compound with the molecular formula C20H14OP+ and a molecular weight of 301.3 g/mol. IUPAC name: dinaphthalen-2-yl(oxo)phosphanium. InChIKey: UJBHOFPPZWFQKO-UHFFFAOYSA-N.
| Molecular formula | C20H14OP+ |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | dinaphthalen-2-yl(oxo)phosphanium |
| InChIKey | UJBHOFPPZWFQKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[P+](=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)
Synonyms:
bis(2-naphthyl)phosphine oxide, Di(naphthalen-2-yl)phosphine oxide, dinaphthalen-2-yl(oxo)phosphanium, 2-[(naphthalen-2-yl)phosphoroso]naphthalene, Di(naphthalen-2-yl)phosphineoxide, di(2-naphthyl)phosphine oxide, di(2-n, bis(2-naphthyl)-oxo-phosphonium, bis(naphthalen-2-yl)phosphine oxide, 2-(2-naphthylphosphonoyl)naphthalene