CAS 13440-07-8 appears in our catalog under these names: Di(naphthalen–1–yl)phosphine oxide, Di(naphthalen-1-yl)phosphine oxide, 97%, 97%, Di(naphthalen-1-yl)phosphine oxide, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
Dinaphthalen-1-yl(oxo)phosphanium (CAS 13440-07-8) is a chemical compound with the molecular formula C20H14OP+ and a molecular weight of 301.3 g/mol. IUPAC name: dinaphthalen-1-yl(oxo)phosphanium. InChIKey: WUEBEOAQRWRUAK-UHFFFAOYSA-N.
| Molecular formula | C20H14OP+ |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | dinaphthalen-1-yl(oxo)phosphanium |
| InChIKey | WUEBEOAQRWRUAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[P+](=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)