cas: 27138-31-4 — see every product listed under this CAS number, including other names
Di(propylene glycol) dibenzoate, 97% (mix), 97% (mix) (CAS 27138-31-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I66A-100g |
| cas | 27138-31-4 |
| size | 100g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 93.20 Pln | |
| Chemat | 500g | 216.00 Pln | |
| Chemat | 1kg | 304.40 Pln |
| purity | 97% (mix) |
|---|---|
| delivery time | 3 weeks |
1-(2-benzoyloxypropoxy)propan-2-yl benzoate (CAS 27138-31-4) is a chemical compound with the molecular formula C20H22O5 and a molecular weight of 342.4 g/mol. IUPAC name: 1-(2-benzoyloxypropoxy)propan-2-yl benzoate. InChIKey: IZYUWBATGXUSIK-UHFFFAOYSA-N.
| Molecular formula | C20H22O5 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 1-(2-benzoyloxypropoxy)propan-2-yl benzoate |
| InChIKey | IZYUWBATGXUSIK-UHFFFAOYSA-N |
| SMILES | CC(COCC(C)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)