CAS 27138-31-4 appears in our catalog under these names: Di(propylene glycol) dibenzoate, 98%, Di(propylene glycol) dibenzoate, Dipropylene glycol dibenzoate 97% (mix), DI(PROPYLENE GLYCOL) DIBENZOATE, 75%, T&, Di(propylene glycol) dibenzoate, 97% (mix), 97% (mix). Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 500g, 100g, 1kg, 5g, 1l, 5l, 1000g.
1-(2-benzoyloxypropoxy)propan-2-yl benzoate (CAS 27138-31-4) is a chemical compound with the molecular formula C20H22O5 and a molecular weight of 342.4 g/mol. IUPAC name: 1-(2-benzoyloxypropoxy)propan-2-yl benzoate. InChIKey: IZYUWBATGXUSIK-UHFFFAOYSA-N.
| Molecular formula | C20H22O5 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 1-(2-benzoyloxypropoxy)propan-2-yl benzoate |
| InChIKey | IZYUWBATGXUSIK-UHFFFAOYSA-N |
| SMILES | CC(COCC(C)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)