cas: 1219020-59-3 — see every product listed under this CAS number, including other names
Di-Tert-Butyl 1-Cyclopropylhydrazine-1,2-Dicarboxylate, 97%, 97% (CAS 1219020-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HGI6-100mg |
| cas | 1219020-59-3 |
| size | 100mg |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 486.80 Pln | |
| Chemat | 500mg | 141.20 Pln | |
| Chemat | 10g | 875.60 Pln | |
| Chemat | 25g | 2032.40 Pln | |
| Chemat | 100g | 7053.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (CAS 1219020-59-3) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate. InChIKey: DDZCNVHWTVEKDS-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl N-cyclopropyl-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| InChIKey | DDZCNVHWTVEKDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C1CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)