cas: 1823301-45-6 — see every product listed under this CAS number, including other names
Di-Tert-Butyl 6-Hydroxy-1,4-Diazepane-1,4-Dicarboxylate, 99%, 99% (CAS 1823301-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I29B-100mg |
| cas | 1823301-45-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 803.60 Pln | |
| Chemat | 250mg | 1341.20 Pln | |
| Chemat | 500mg | 2061.20 Pln | |
| Chemat | 1g | 3222.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate (CAS 1823301-45-6) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate. InChIKey: CNXHKECPYYPLBF-UHFFFAOYSA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | ditert-butyl 6-hydroxy-1,4-diazepane-1,4-dicarboxylate |
| InChIKey | CNXHKECPYYPLBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(C1)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)