cas: 471239-60-8 — see every product listed under this CAS number, including other names
Di-tert-butyl (4-bromo-1,2-phenylene)dicarbamate, 97%, 97% (CAS 471239-60-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRVX-250mg |
| cas | 471239-60-8 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 10g | 741.20 Pln | |
| Chemat | 25g | 1418.00 Pln | |
| Chemat | 100g | 3899.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (CAS 471239-60-8) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate. InChIKey: LJKCSTXFYRULGQ-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| InChIKey | LJKCSTXFYRULGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)