cas: 1464788-84-8 — see every product listed under this CAS number, including other names
Di-tert-butyl (4-chloropyrimidin-2-yl)imidodicarbonate, 95%, 95% (CAS 1464788-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112E31-100mg |
| cas | 1464788-84-8 |
| size | 100mg |
| availability | 160g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 702.80 Pln | |
| Chemat | 10g | 1341.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1464788-84-8) is a chemical compound with the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. IUPAC name: tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: LTWPYVSBBSMSNR-UHFFFAOYSA-N.
| Molecular formula | C14H20ClN3O4 |
|---|---|
| Molecular weight | 329.78 g/mol |
| IUPAC name | tert-butyl N-(4-chloropyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | LTWPYVSBBSMSNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=CC(=N1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)