cas: 368441-99-0 — see every product listed under this CAS number, including other names
Di-tert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate, 95% (CAS 368441-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545907-100MG |
| cas | 368441-99-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 575.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate (CAS 368441-99-0) is a chemical compound with the molecular formula C17H30N2O6 and a molecular weight of 358.4 g/mol. IUPAC name: ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate. InChIKey: KHNDFFYHELWSII-UHFFFAOYSA-N.
| Molecular formula | C17H30N2O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate |
| InChIKey | KHNDFFYHELWSII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)CC(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)