cas: 368441-99-0 — see every product listed under this CAS number, including other names
METHYL 1,4-DI-BOC-PIPERAZINE-2-ACETATE, 98%, 98% (CAS 368441-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY6R-100mg |
| cas | 368441-99-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1384.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate (CAS 368441-99-0) is a chemical compound with the molecular formula C17H30N2O6 and a molecular weight of 358.4 g/mol. IUPAC name: ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate. InChIKey: KHNDFFYHELWSII-UHFFFAOYSA-N.
| Molecular formula | C17H30N2O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | ditert-butyl 2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate |
| InChIKey | KHNDFFYHELWSII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)CC(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)