Dibemethine, 97%
cas: 102-05-6 — see every product listed under this CAS number, including other names
Dibemethine, 97% (CAS 102-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F463446-250MG |
| cas | 102-05-6 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 711.23 Pln | |
| Fluorochem | 25g | 1664.02 Pln | |
| Fluorochem | 100g | 5308.57 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 587.31 Pln | |
| Ambeed | 25g | 1349.38 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
N-benzyl-N-methyl-1-phenylmethanamine (CAS 102-05-6) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: N-benzyl-N-methyl-1-phenylmethanamine. InChIKey: WYZDCUGWXKHESN-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | N-benzyl-N-methyl-1-phenylmethanamine |
| InChIKey | WYZDCUGWXKHESN-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)