cas: 24444-75-5 — see every product listed under this CAS number, including other names
Dibenzo[b,d]thiophen-4-ol 95+% (CAS 24444-75-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A281050-250mg |
| cas | 24444-75-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 2033.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A281050 |
Dibenzothiophen-4-ol (CAS 24444-75-5) is a chemical compound with the molecular formula C12H8OS and a molecular weight of 200.26 g/mol. IUPAC name: dibenzothiophen-4-ol. InChIKey: SUBWJLQUFMWZRI-UHFFFAOYSA-N.
| Molecular formula | C12H8OS |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | dibenzothiophen-4-ol |
| InChIKey | SUBWJLQUFMWZRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)O |
Computed by PubChem (NCBI)