cas: 17176-77-1 — see every product listed under this CAS number, including other names
Dibenzyl phosphonate 95% (CAS 17176-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A318970-1g |
| cas | 17176-77-1 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 331.44 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 1516.25 Pln | |
| Ambeed | 500g | 3702.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A318970 |
Oxo-bis(phenylmethoxy)phosphanium (CAS 17176-77-1) is a chemical compound with the molecular formula C14H14O3P+ and a molecular weight of 261.23 g/mol. IUPAC name: oxo-bis(phenylmethoxy)phosphanium. InChIKey: RQKYHDHLEMEVDR-UHFFFAOYSA-N.
| Molecular formula | C14H14O3P+ |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | oxo-bis(phenylmethoxy)phosphanium |
| InChIKey | RQKYHDHLEMEVDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CO[P+](=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)