CAS 17176-77-1 appears in our catalog under these names: Dibenzyl Phosphite, >95% (HPLC), Dibenzyl Phosphite, Dibenzyl phosphite, 90+% , Dibenzyl Phosphite, >95.0%(GC), Dibenzyl phosphite, 90+%, technical. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 5g, 250g, 1g, 10g, 500g, 1kg.
Oxo-bis(phenylmethoxy)phosphanium (CAS 17176-77-1) is a chemical compound with the molecular formula C14H14O3P+ and a molecular weight of 261.23 g/mol. IUPAC name: oxo-bis(phenylmethoxy)phosphanium. InChIKey: RQKYHDHLEMEVDR-UHFFFAOYSA-N.
| Molecular formula | C14H14O3P+ |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | oxo-bis(phenylmethoxy)phosphanium |
| InChIKey | RQKYHDHLEMEVDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CO[P+](=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)