cas: 48165-50-0 — see every product listed under this CAS number, including other names
Dibromo(1,10-phenanthroline-κN1,κN10)nickel, 98%, 98% (CAS 48165-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JX50-100mg |
| cas | 48165-50-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1302.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dibromonickel;1,10-phenanthroline (CAS 48165-50-0) is a chemical compound with the molecular formula C12H8Br2N2Ni and a molecular weight of 398.71 g/mol. IUPAC name: dibromonickel;1,10-phenanthroline. InChIKey: XCUCYFXAOLWFSN-UHFFFAOYSA-L.
| Molecular formula | C12H8Br2N2Ni |
|---|---|
| Molecular weight | 398.71 g/mol |
| IUPAC name | dibromonickel;1,10-phenanthroline |
| InChIKey | XCUCYFXAOLWFSN-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[Ni](Br)Br |
Computed by PubChem (NCBI)