CAS 48165-50-0 appears in our catalog under these names: (phen)nibr2, 95%, Dibromo(1,10–phenanthroline–κN1,κN10)nickel, Ni(phen)Br2 98%, 1,10-PHENANTHROLINE NICKEL (II) DIBROMI, Dibromo(1,10-phenanthroline-κN1,κN10)nickel, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 250mg, 10g.
Dibromonickel;1,10-phenanthroline (CAS 48165-50-0) is a chemical compound with the molecular formula C12H8Br2N2Ni and a molecular weight of 398.71 g/mol. IUPAC name: dibromonickel;1,10-phenanthroline. InChIKey: XCUCYFXAOLWFSN-UHFFFAOYSA-L.
| Molecular formula | C12H8Br2N2Ni |
|---|---|
| Molecular weight | 398.71 g/mol |
| IUPAC name | dibromonickel;1,10-phenanthroline |
| InChIKey | XCUCYFXAOLWFSN-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[Ni](Br)Br |
Computed by PubChem (NCBI)