CAS 1067-33-0 appears in our catalog under these names: Dibutyltin Diacetate, Dibutyltin diacetate (EVE/EUD), Di-n-butyltin diacetate, 95% , Dibutyltin Diacetate, >95.0%(W), Dibutyltin diacetate, 95.00%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 500g, 50g, 250g, 1kg, 25g, 100g, 250ML, 50ML.
[acetyloxy(dibutyl)stannyl] acetate (CAS 1067-33-0) is a chemical compound with the molecular formula C12H24O4Sn and a molecular weight of 351.03 g/mol. IUPAC name: [acetyloxy(dibutyl)stannyl] acetate. InChIKey: JJLKTTCRRLHVGL-UHFFFAOYSA-L.
| Molecular formula | C12H24O4Sn |
|---|---|
| Molecular weight | 351.03 g/mol |
| IUPAC name | [acetyloxy(dibutyl)stannyl] acetate |
| InChIKey | JJLKTTCRRLHVGL-UHFFFAOYSA-L |
| SMILES | CCCC[Sn](CCCC)(OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)