CAS 14784-26-0 is the registry number for Dichlorobis(dimethylglyoxime)cobalt(II), 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
Dichlorocobalt;bis(N-(3-hydroxyiminobutan-2-ylidene)hydroxylamine) (CAS 14784-26-0) is a chemical compound with the molecular formula C8H16Cl2CoN4O4 and a molecular weight of 362.07 g/mol. IUPAC name: dichlorocobalt;bis(N-(3-hydroxyiminobutan-2-ylidene)hydroxylamine). InChIKey: VJCBNQCZLZRPPK-UHFFFAOYSA-L.
| Molecular formula | C8H16Cl2CoN4O4 |
|---|---|
| Molecular weight | 362.07 g/mol |
| IUPAC name | dichlorocobalt;bis(N-(3-hydroxyiminobutan-2-ylidene)hydroxylamine) |
| InChIKey | VJCBNQCZLZRPPK-UHFFFAOYSA-L |
| SMILES | CC(=NO)C(=NO)C.CC(=NO)C(=NO)C.Cl[Co]Cl |
Computed by PubChem (NCBI)