cas: 42822-57-1 — see every product listed under this CAS number, including other names
Diethyl (4-aminophenyl)phosphonate 95% (CAS 42822-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192556-100mg |
| cas | 42822-57-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 5204.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192556 |
4-diethoxyphosphorylaniline (CAS 42822-57-1) is a chemical compound with the molecular formula C10H16NO3P and a molecular weight of 229.21 g/mol. IUPAC name: 4-diethoxyphosphorylaniline. InChIKey: OIGQTUBEBRLSOX-UHFFFAOYSA-N.
| Molecular formula | C10H16NO3P |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 4-diethoxyphosphorylaniline |
| InChIKey | OIGQTUBEBRLSOX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=CC=C(C=C1)N)OCC |
Computed by PubChem (NCBI)