cas: 42822-57-1 — see every product listed under this CAS number, including other names
Diethyl (4-aminophenyl)phosphonate, 97%, 97% (CAS 42822-57-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1182FT-50mg |
| cas | 42822-57-1 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1485.20 Pln | |
| Chemat | 5g | 4528.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-diethoxyphosphorylaniline (CAS 42822-57-1) is a chemical compound with the molecular formula C10H16NO3P and a molecular weight of 229.21 g/mol. IUPAC name: 4-diethoxyphosphorylaniline. InChIKey: OIGQTUBEBRLSOX-UHFFFAOYSA-N.
| Molecular formula | C10H16NO3P |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 4-diethoxyphosphorylaniline |
| InChIKey | OIGQTUBEBRLSOX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=CC=C(C=C1)N)OCC |
Computed by PubChem (NCBI)