cas: 51335-75-2 — see every product listed under this CAS number, including other names
Diethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate, 96% (CAS 51335-75-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222599-1G |
| cas | 51335-75-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 445.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate (CAS 51335-75-2) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: diethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate. InChIKey: LRRLQBPVLCTGIE-UHFFFAOYSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | diethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate |
| InChIKey | LRRLQBPVLCTGIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(COC(OC1)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)