Products 32717-65-0
CAS 32717-65-0 is the registry number for 2,3:4,6-Di-o-isopropylidene-alpha-l-sorbofuranose, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,3',3'-tetramethylspiro[1,3-dioxolane-4,6'-2,4,7-trioxabicyclo[3.3.1]nonane]-9'-ol (CAS 32717-65-0) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: 2,2,3',3'-tetramethylspiro[1,3-dioxolane-4,6'-2,4,7-trioxabicyclo[3.3.1]nonane]-9'-ol. InChIKey: HIHGMQOBMJOZKO-UHFFFAOYSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 2,2,3',3'-tetramethylspiro[1,3-dioxolane-4,6'-2,4,7-trioxabicyclo[3.3.1]nonane]-9'-ol |
| InChIKey | HIHGMQOBMJOZKO-UHFFFAOYSA-N |
| SMILES | CC1(OCC2(O1)C3C(C(CO2)OC(O3)(C)C)O)C |
Computed by PubChem (NCBI)