cas: 64362-41-0 — see every product listed under this CAS number, including other names
Diethyl 2-(3-nitropyridin-2-yl)malonate, 95%, 95% (CAS 64362-41-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EG3F-250mg |
| cas | 64362-41-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-(3-nitro-2-pyridinyl)propanedioate (CAS 64362-41-0) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: diethyl 2-(3-nitro-2-pyridinyl)propanedioate. InChIKey: IMGOJADWUZXLFZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | diethyl 2-(3-nitro-2-pyridinyl)propanedioate |
| InChIKey | IMGOJADWUZXLFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=CC=N1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)