Products 180505-97-9
CAS 180505-97-9 is the registry number for 4-(3-Ethoxy-3-oxopropylamino)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(3-ethoxy-3-oxopropyl)amino]-3-nitrobenzoic acid (CAS 180505-97-9) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: 4-[(3-ethoxy-3-oxopropyl)amino]-3-nitrobenzoic acid. InChIKey: HSWVJLUGKAOGSC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 4-[(3-ethoxy-3-oxopropyl)amino]-3-nitrobenzoic acid |
| InChIKey | HSWVJLUGKAOGSC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)