Diethyl 2-isopropylmalonate, 98%, 98%
cas: 759-36-4 — see every product listed under this CAS number, including other names
Diethyl 2-isopropylmalonate, 98%, 98% (CAS 759-36-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145QD-5g |
| cas | 759-36-4 |
| size | 5g |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 200g | 165.20 Pln | |
| Chemat | 300g | 213.20 Pln | |
| Chemat | 400g | 261.20 Pln | |
| Chemat | 500g | 379.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-propan-2-ylpropanedioate (CAS 759-36-4) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: diethyl 2-propan-2-ylpropanedioate. InChIKey: BYQFBFWERHXONI-UHFFFAOYSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | diethyl 2-propan-2-ylpropanedioate |
| InChIKey | BYQFBFWERHXONI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)C)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
DIETHYL ISOPROPYLMALONATE, Propanedioic acid, (1-methylethyl)-, diethyl ester, InChI=1/C10H18O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h7-8H,5-6H2,1-4H, Diethyl 2-isopropylmalonate, Isopropyl diethyl malonate, 1,3-diethyl 2-(propan-2-yl)propanedioate, diethyl 2-propan-2-ylpropanedioate, Ethyl isopropylmalonate, Isopropylmalonic acid diethyl ester, diethyl 2-isopropylpropanedioate